ChemNet > CAS > 881-03-8 2-Methyl-1-nitronaphthalene
881-03-8 2-Methyl-1-nitronaphthalene
Naam product |
2-Methyl-1-nitronaphthalene |
Synoniemen |
Naphthalene, 2-methyl-1-nitro-; 1-Nitro-2-methylnaphthalene; 4-05-00-01698 (Beilstein Handbook Reference); BRN 1954310; CCRIS 4680; NSC 7516 |
MF |
C11H9NO2 |
Molecuulgewicht |
187.1947 |
InChI |
InChI=1/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
CAS-nummer |
881-03-8 |
EINECS |
212-917-5 |
Moleculaire Structuur |
|
Dichtheid |
1.234g/cm3 |
Smeltpunt |
79-82℃ |
Kookpunt |
320.5°C at 760 mmHg |
Brekingsindex |
1.652 |
Vlampunt |
150.4°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|