ChemNet > CAS > 88105-17-3 Methyl 3-chlorothiophene-2-carboxylate
88105-17-3 Methyl 3-chlorothiophene-2-carboxylate
| Naam product |
Methyl 3-chlorothiophene-2-carboxylate |
| MF |
C6H5ClO2S |
| Molecuulgewicht |
176.6207 |
| InChI |
InChI=1/C6H5ClO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,1H3 |
| CAS-nummer |
88105-17-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.371g/cm3 |
| Smeltpunt |
37-74℃ |
| Kookpunt |
239°C at 760 mmHg |
| Brekingsindex |
1.554 |
| Vlampunt |
98.3°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
