ChemNet > CAS > 933-76-6 4,5-Dichloro-2-methylpyridazin-3-one
933-76-6 4,5-Dichloro-2-methylpyridazin-3-one
Naam product |
4,5-Dichloro-2-methylpyridazin-3-one |
Synoniemen |
3(2H)-Pyridazinone, 4,5-dichloro-2-methyl-; 4,5-Dichloro-2-methyl-3(2H)-pyridazinone; 5-24-02-00023 (Beilstein Handbook Reference); BRN 0127609; 4,5-dichloro-2-methylpyridazin-3(2H)-one |
MF |
C5H4Cl2N2O |
Molecuulgewicht |
179.0041 |
InChI |
InChI=1/C5H4Cl2N2O/c1-9-5(10)4(7)3(6)2-8-9/h2H,1H3 |
CAS-nummer |
933-76-6 |
Moleculaire Structuur |
|
Dichtheid |
1.55g/cm3 |
Kookpunt |
197.2°C at 760 mmHg |
Brekingsindex |
1.611 |
Vlampunt |
73.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|