ChemNet > CAS > 93560-55-5 2-Iodo-3-methoxypyridine
93560-55-5 2-Iodo-3-methoxypyridine
Naam product |
2-Iodo-3-methoxypyridine |
MF |
C6H6INO |
Molecuulgewicht |
235.0224 |
InChI |
InChI=1/C6H6INO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
CAS-nummer |
93560-55-5 |
Moleculaire Structuur |
|
Dichtheid |
1.825g/cm3 |
Kookpunt |
271.2°C at 760 mmHg |
Brekingsindex |
1.598 |
Vlampunt |
117.8°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|