ChemNet > CAS > 98919-15-4 1,2-dichloro-4-(2,2-diethoxyethoxy)benzene
98919-15-4 1,2-dichloro-4-(2,2-diethoxyethoxy)benzene
Naam product |
1,2-dichloro-4-(2,2-diethoxyethoxy)benzene |
MF |
C12H16Cl2O3 |
Molecuulgewicht |
279.1596 |
InChI |
InChI=1/C12H16Cl2O3/c1-3-15-12(16-4-2)8-17-9-5-6-10(13)11(14)7-9/h5-7,12H,3-4,8H2,1-2H3 |
CAS-nummer |
98919-15-4 |
Moleculaire Structuur |
|
Dichtheid |
1.198g/cm3 |
Kookpunt |
352.1°C at 760 mmHg |
Brekingsindex |
1.507 |
Vlampunt |
123.6°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|