ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
produktnavn |
2-bromo-4-fluoroacetophenone |
Synonymer |
2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
Molekylær Formel |
C8H6BrFO |
Molekylvekt |
217.035 |
InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
CAS-nummer |
1006-39-9 |
EINECS |
222-263-2 |
Molecular Structure |
|
Tetthet |
1.535g/cm3 |
Kokepunkt |
258.4°C at 760 mmHg |
Brytningsindeks |
1.534 |
Flammepunktet |
110.1°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|