10352-88-2 trans-2-heptensyre
produktnavn |
trans-2-heptensyre |
Synonymer |
; Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-ensyre |
Engelsk navn |
trans-2-Heptenoic acid; Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid |
Molekylær Formel |
C7H12O2 |
Molekylvekt |
128.169 |
InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
CAS-nummer |
10352-88-2 |
EINECS |
233-769-8 |
Molecular Structure |
|
Tetthet |
0.968g/cm3 |
Kokepunkt |
226.6°C at 760 mmHg |
Brytningsindeks |
1.457 |
Flammepunktet |
133.4°C |
Damptrykk |
0.0295mmHg at 25°C |
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|