ChemNet > CAS > 131738-73-3 1-Bromo-3-isopropoxybenzene
131738-73-3 1-Bromo-3-isopropoxybenzene
produktnavn |
1-Bromo-3-isopropoxybenzene |
Synonymer |
2-(3-Bromophenoxy)propane~3-Bromophenyl isopropyl ether; 3-Bromophenyl isopropyl ether; 1-bromo-3-(1-methylethoxy)benzene |
Molekylær Formel |
C9H11BrO |
Molekylvekt |
215.087 |
InChI |
InChI=1/C9H11BrO/c1-7(2)11-9-5-3-4-8(10)6-9/h3-7H,1-2H3 |
CAS-nummer |
131738-73-3 |
Molecular Structure |
|
Tetthet |
1.319g/cm3 |
Kokepunkt |
232°C at 760 mmHg |
Brytningsindeks |
1.523 |
Flammepunktet |
104.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|