ChemNet > CAS > 175278-27-0 2,4-dichloro-6-methylbenzamide
175278-27-0 2,4-dichloro-6-methylbenzamide
produktnavn |
2,4-dichloro-6-methylbenzamide |
Molekylær Formel |
C8H7Cl2NO |
Molekylvekt |
204.0533 |
InChI |
InChI=1/C8H7Cl2NO/c1-4-2-5(9)3-6(10)7(4)8(11)12/h2-3H,1H3,(H2,11,12) |
CAS-nummer |
175278-27-0 |
Molecular Structure |
|
Tetthet |
1.375g/cm3 |
Smeltepunkt |
151℃ |
Kokepunkt |
265.1°C at 760 mmHg |
Brytningsindeks |
1.586 |
Flammepunktet |
114.1°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|