ChemNet > CAS > 17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
produktnavn |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
Synonymer |
3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
Molekylær Formel |
C8H11ClO |
Molekylvekt |
158.6253 |
InChI |
InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
CAS-nummer |
17530-69-7 |
Molecular Structure |
|
Tetthet |
1.09g/cm3 |
Kokepunkt |
217.7°C at 760 mmHg |
Brytningsindeks |
1.488 |
Flammepunktet |
104.8°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|