ChemNet > CAS > 1916-08-1 3-hydroxy-4,5-dimethoxybenzoic acid
1916-08-1 3-hydroxy-4,5-dimethoxybenzoic acid
produktnavn |
3-hydroxy-4,5-dimethoxybenzoic acid |
Synonymer |
5-Hydroxy-3,4-dimethoxybenzoic acid; 3,4-Dimethoxy-5-hydroxybenzoic acid~5-Hydroxyveratric acid |
Molekylær Formel |
C9H10O5 |
Molekylvekt |
198.1727 |
InChI |
InChI=1/C9H10O5/c1-13-7-4-5(9(11)12)3-6(10)8(7)14-2/h3-4,10H,1-2H3,(H,11,12) |
CAS-nummer |
1916-08-1 |
EINECS |
217-630-9 |
Molecular Structure |
|
Tetthet |
1.335g/cm3 |
Kokepunkt |
374.2°C at 760 mmHg |
Brytningsindeks |
1.566 |
Flammepunktet |
152.6°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|