ChemNet > CAS > 19812-63-6 Diethyl tetradecanedioate
19812-63-6 Diethyl tetradecanedioate
| produktnavn |
Diethyl tetradecanedioate |
| Synonymer |
AI3-11781; Tetradecanedioic acid, diethyl ester |
| Molekylær Formel |
C18H34O4 |
| Molekylvekt |
314.4602 |
| InChI |
InChI=1/C18H34O4/c1-3-21-17(19)15-13-11-9-7-5-6-8-10-12-14-16-18(20)22-4-2/h3-16H2,1-2H3 |
| CAS-nummer |
19812-63-6 |
| EINECS |
243-340-7 |
| Molecular Structure |
|
| Tetthet |
0.945g/cm3 |
| Smeltepunkt |
28-31℃ |
| Kokepunkt |
351.3°C at 760 mmHg |
| Brytningsindeks |
1.447 |
| Flammepunktet |
106.1°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
