ChemNet > CAS > 201058-08-4 Wang resin
201058-08-4 Wang resin
| produktnavn |
Wang resin |
| Synonymer |
4-Benzyloxybenzyl alcohol, polymer-supported~Polystyrene PHB; [4-(Hydroxymethyl)phenoxymethyl]polystyrene divinylbenzene copolymer; {4-[(4-methylbenzyl)oxy]phenyl}methanol |
| Molekylær Formel |
C15H16O2 |
| Molekylvekt |
228.2863 |
| InChI |
InChI=1/C15H16O2/c1-12-2-4-14(5-3-12)11-17-15-8-6-13(10-16)7-9-15/h2-9,16H,10-11H2,1H3 |
| CAS-nummer |
201058-08-4 |
| Molecular Structure |
|
| Tetthet |
1.117g/cm3 |
| Kokepunkt |
386.2°C at 760 mmHg |
| Brytningsindeks |
1.587 |
| Flammepunktet |
175.2°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
