ChemNet > CAS > 2103-88-0 2-Mercapto-4-phenylthiazole
2103-88-0 2-Mercapto-4-phenylthiazole
produktnavn |
2-Mercapto-4-phenylthiazole |
Synonymer |
4-Phenyl-2-thiazolethiol; 4-phenyl-1,3-thiazole-2(3H)-thione |
Molekylær Formel |
C9H7NS2 |
Molekylvekt |
193.2886 |
InChI |
InChI=1/C9H7NS2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-6H,(H,10,11) |
CAS-nummer |
2103-88-0 |
EINECS |
218-274-7 |
Molecular Structure |
|
Tetthet |
1.37g/cm3 |
Kokepunkt |
333.1°C at 760 mmHg |
Brytningsindeks |
1.744 |
Flammepunktet |
155.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|