ChemNet > CAS > 214759-74-7 4-morpholinobenzylamine
214759-74-7 4-morpholinobenzylamine
produktnavn |
4-morpholinobenzylamine |
Synonymer |
(4-morpholinophenyl)methanamine; [4-(Morpholin-4-yl)benzyl]amine |
Molekylær Formel |
C11H16N2O |
Molekylvekt |
192.2575 |
InChI |
InChI=1/C11H16N2O/c12-9-10-1-3-11(4-2-10)13-5-7-14-8-6-13/h1-4H,5-9,12H2 |
CAS-nummer |
214759-74-7 |
Molecular Structure |
|
Tetthet |
1.113g/cm3 |
Smeltepunkt |
44℃ |
Kokepunkt |
361.354°C at 760 mmHg |
Brytningsindeks |
1.568 |
Flammepunktet |
172.341°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|