ChemNet > CAS > 24431-27-4 (4-Ethylphenoxy)-acetic acid
24431-27-4 (4-Ethylphenoxy)-acetic acid
| produktnavn |
(4-Ethylphenoxy)-acetic acid |
| Synonymer |
4-Ethylphenoxyacetic acid |
| Molekylær Formel |
C10H12O3 |
| Molekylvekt |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-8-3-5-9(6-4-8)13-7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12) |
| CAS-nummer |
24431-27-4 |
| EINECS |
246-245-9 |
| Molecular Structure |
|
| Tetthet |
1.144g/cm3 |
| Kokepunkt |
309.6°C at 760 mmHg |
| Brytningsindeks |
1.53 |
| Flammepunktet |
121.6°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
