ChemNet > CAS > 2757-23-5 chlorocarbonylsulfenyl chloride
2757-23-5 chlorocarbonylsulfenyl chloride
| produktnavn |
chlorocarbonylsulfenyl chloride |
| Synonymer |
Chloro(chlorosulfanyl)oxomethane; Methane, chloro(chlorothio)oxo- |
| Molekylær Formel |
CCl2OS |
| Molekylvekt |
130.9811 |
| InChI |
InChI=1/CCl2OS/c2-1(4)5-3 |
| CAS-nummer |
2757-23-5 |
| EINECS |
220-415-2 |
| Molecular Structure |
|
| Tetthet |
1.66g/cm3 |
| Kokepunkt |
98°C at 760 mmHg |
| Brytningsindeks |
1.53 |
| Flammepunktet |
53.7°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
