produktnavn |
4-(2,4-diklorfenoksy)smørsyre, forbindelse med dimetylamin (1:1) |
Synonymer |
2,4-DB-dimetylammonium [ISO]; 2,4-DB dimetylamin salt; 2,4-DB-dimetylammonium; 4-(2,4-diklorfenoksy)smørsyredimetylaminsalt; CCRIS 8800; Caswell nr.316C; EPA plantevernmiddel kjemisk kode 030819; 4-(2,4-diklorfenoksy)smørsyre, forbindelse med dimetylamin (1:1); Butansyre, 4-(2,4-diklorfenoksy)-, compd.med N-metylmetamin (1:1); Smørsyre, 4-(2,4-diklorfenoksy)-, dimetylaminsalt; Dimetylamin 4-(2,4-diklorfenoksy)butyrat; 4-(2,4-diklorfenoksy)butansyre - N-metylmetamin (1:1) |
Engelsk navn |
4-(2,4-dichlorophenoxy)butyric acid, compound with dimethylamine (1:1);2,4-DB-dimethylammonium [ISO]; 2,4-DB dimethylamine salt; 2,4-DB-Dimethylammonium; 4-(2,4-Dichlorophenoxy)butyric acid dimethylamine salt; CCRIS 8800; Caswell No. 316C; EPA Pesticide Chemical Code 030819; 4-(2,4-Dichlorophenoxy)butyric acid, compound with dimethylamine (1:1); Butanoic acid, 4-(2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1); Butyric acid, 4-(2,4-dichlorophenoxy)-, dimethylamine salt; Dimethylamine 4-(2,4-dichlorophenoxy)butyrate; 4-(2,4-dichlorophenoxy)butanoic acid - N-methylmethanamine (1:1) |
Molekylær Formel |
C12H17Cl2NO3 |
Molekylvekt |
294.1743 |
InChI |
InChI=1/C10H10Cl2O3.C2H7N/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;1-3-2/h3-4,6H,1-2,5H2,(H,13,14);3H,1-2H3 |
CAS-nummer |
2758-42-1 |
EINECS |
220-422-0 |
Molecular Structure |
|
Kokepunkt |
410.4°C at 760 mmHg |
Flammepunktet |
202°C |
Damptrykk |
1.8E-07mmHg at 25°C |
|