ChemNet > CAS > 30806-83-8 Ethyl 4-isocyanatobenzoate
30806-83-8 Ethyl 4-isocyanatobenzoate
| produktnavn |
Ethyl 4-isocyanatobenzoate |
| Synonymer |
4-(Ethoxycarbonyl)phenyl isocyanate; 4-Carboethoxyphenyl isocyanate; 4-Isocyanatobenzoic acid ethyl ester |
| Molekylær Formel |
C10H9NO3 |
| Molekylvekt |
191.1834 |
| InChI |
InChI=1/C10H9NO3/c1-2-14-10(13)8-3-5-9(6-4-8)11-7-12/h3-6H,2H2,1H3 |
| CAS-nummer |
30806-83-8 |
| EINECS |
250-344-2 |
| Molecular Structure |
|
| Tetthet |
1.12g/cm3 |
| Smeltepunkt |
27-29℃ |
| Kokepunkt |
313.2°C at 760 mmHg |
| Brytningsindeks |
1.524 |
| Flammepunktet |
126.7°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
