ChemNet > CAS > 32253-75-1 5-Bromo-N-(carboxymethyl)anthranilic acid
32253-75-1 5-Bromo-N-(carboxymethyl)anthranilic acid
produktnavn |
5-Bromo-N-(carboxymethyl)anthranilic acid |
Synonymer |
N-(4-Bromo-2-carboxyphenyl)glycine; 5-bromo-2-[(carboxymethyl)amino]benzoic acid; 5-bromo-2-[(carboxylatomethyl)amino]benzoate |
Molekylær Formel |
C9H6BrNO4 |
Molekylvekt |
272.0533 |
InChI |
InChI=1/C9H8BrNO4/c10-5-1-2-7(11-4-8(12)13)6(3-5)9(14)15/h1-3,11H,4H2,(H,12,13)(H,14,15)/p-2 |
CAS-nummer |
32253-75-1 |
EINECS |
250-973-2 |
Molecular Structure |
|
Smeltepunkt |
215-218℃ |
Kokepunkt |
517°C at 760 mmHg |
Flammepunktet |
266.5°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|