CAS No: 33471-33-9, Chemical Name: (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
the physical and chemical property of 33471-33-9, (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone is provided by ChemNet.com
ChemNet > CAS > 33471-33-9 (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
33471-33-9 (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
produktnavn |
(2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone |
Synonymer |
(2R,3S,4S,5S,6S)-2,3,4,5,6-Pentahydroxycyclohexanone; cyclohexanone, 2,3,4,5,6-pentahydroxy-, (2α,3α,4α,5β,6α)- |
Molekylær Formel |
C6H10O6 |
Molekylvekt |
178.14 |
InChI |
InChI=1/C6H10O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-5,7-11H/t1-,2-,3-,4+,5-/m0/s1 |
CAS-nummer |
33471-33-9 |
Molecular Structure |
|
Tetthet |
2.027g/cm3 |
Kokepunkt |
368.552°C at 760 mmHg |
Brytningsindeks |
1.749 |
Flammepunktet |
190.876°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
|
|