ChemNet > CAS > 3760-20-1 2-ethylcyclohexanol, mixture of cis and tran
3760-20-1 2-ethylcyclohexanol, mixture of cis and tran
produktnavn |
2-ethylcyclohexanol, mixture of cis and tran |
Molekylær Formel |
C8H16O |
Molekylvekt |
128.212 |
InChI |
InChI=1/C8H16O/c1-2-7-5-3-4-6-8(7)9/h7-9H,2-6H2,1H3 |
CAS-nummer |
3760-20-1 |
EINECS |
223-174-1 |
Molecular Structure |
|
Tetthet |
0.909g/cm3 |
Kokepunkt |
175°C at 760 mmHg |
Brytningsindeks |
1.459 |
Flammepunktet |
68.3°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
|
|