ChemNet > CAS > 4151-80-8 4,4'-Biphenyldiboronic acid
4151-80-8 4,4'-Biphenyldiboronic acid
| produktnavn |
4,4'-Biphenyldiboronic acid |
| Synonymer |
biphenyl-4,4'-diyldiboronic acid |
| Molekylær Formel |
C12H12B2O4 |
| Molekylvekt |
241.8433 |
| InChI |
InChI=1/C12H12B2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8,15-18H |
| CAS-nummer |
4151-80-8 |
| Molecular Structure |
|
| Tetthet |
1.31g/cm3 |
| Smeltepunkt |
300℃ (dec.) |
| Kokepunkt |
505.9°C at 760 mmHg |
| Brytningsindeks |
1.62 |
| Flammepunktet |
259.7°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
