ChemNet > CAS > 41963-20-6 4-Bromo-3-methylbenzonitrile
41963-20-6 4-Bromo-3-methylbenzonitrile
produktnavn |
4-Bromo-3-methylbenzonitrile |
Synonymer |
4-Bromo-m-tolunitrile (CN=1); 3-Methyl-4-bromobenzonitrile |
Molekylær Formel |
C8H6BrN |
Molekylvekt |
196.0439 |
InChI |
InChI=1/C8H6BrN/c1-6-4-7(5-10)2-3-8(6)9/h2-4H,1H3 |
CAS-nummer |
41963-20-6 |
Molecular Structure |
|
Tetthet |
1.51g/cm3 |
Kokepunkt |
265°C at 760 mmHg |
Brytningsindeks |
1.59 |
Flammepunktet |
114.1°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|