ChemNet > CAS > 43111-32-6 3-Chlorophenoxyacetonitrile
43111-32-6 3-Chlorophenoxyacetonitrile
produktnavn |
3-Chlorophenoxyacetonitrile |
Molekylær Formel |
C8H6ClNO |
Molekylvekt |
167.5923 |
InChI |
InChI=1/C8H6ClNO/c9-7-2-1-3-8(6-7)11-5-4-10/h1-3,6H,5H2 |
CAS-nummer |
43111-32-6 |
Molecular Structure |
|
Tetthet |
1.238g/cm3 |
Smeltepunkt |
30℃ |
Kokepunkt |
279.8°C at 760 mmHg |
Brytningsindeks |
1.538 |
Flammepunktet |
123°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|