ChemNet > CAS > 4337-66-0 Benzoic acid, compound with 2-aminoethanol (1:1)
4337-66-0 Benzoic acid, compound with 2-aminoethanol (1:1)
| produktnavn |
Benzoic acid, compound with 2-aminoethanol (1:1) |
| Synonymer |
Ethanolamine benzoate; Benzenecarboxylic acid, ethanolamine salt; Benzoic acid, ethanolamine salt; Monoethanolamine benzoate; Benzoic acid, compd. with 2-aminoethanol (1:1); Ethanol, 2-amino-, benzoate (1:1); Ethanol, 2-amino-, benzoate (salt); 2-hydroxyethanaminium benzoate |
| Molekylær Formel |
C9H13NO3 |
| Molekylvekt |
183.2044 |
| InChI |
InChI=1/C7H6O2.C2H7NO/c8-7(9)6-4-2-1-3-5-6;3-1-2-4/h1-5H,(H,8,9);4H,1-3H2 |
| CAS-nummer |
4337-66-0 |
| EINECS |
224-387-2 |
| Molecular Structure |
|
| Kokepunkt |
249.3°C at 760 mmHg |
| Flammepunktet |
111.4°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
|
|
