ChemNet > CAS > 4347-31-3 2-Formylthiophene-3-boronic acid
4347-31-3 2-Formylthiophene-3-boronic acid
| produktnavn |
2-Formylthiophene-3-boronic acid |
| Synonymer |
3-Boronothiophene-2-carboxaldehyde; (2-Formyl-3-thienyl)boronic acid; (2-formylthiophen-3-yl)boronic acid |
| Molekylær Formel |
C5H5BO3S |
| Molekylvekt |
155.9674 |
| InChI |
InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
| CAS-nummer |
4347-31-3 |
| Molecular Structure |
|
| Tetthet |
1.41g/cm3 |
| Smeltepunkt |
167-173℃ |
| Kokepunkt |
396.7°C at 760 mmHg |
| Brytningsindeks |
1.573 |
| Flammepunktet |
193.7°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
