ChemNet > CAS > 4640-68-0 3,4-Dichlorobenzoylacetonitrile
4640-68-0 3,4-Dichlorobenzoylacetonitrile
produktnavn |
3,4-Dichlorobenzoylacetonitrile |
Synonymer |
3-(3,4-dichlorophenyl)-3-oxopropanenitrile |
Molekylær Formel |
C9H5Cl2NO |
Molekylvekt |
214.0481 |
InChI |
InChI=1/C9H5Cl2NO/c10-7-2-1-6(5-8(7)11)9(13)3-4-12/h1-2,5H,3H2 |
CAS-nummer |
4640-68-0 |
Molecular Structure |
|
Tetthet |
1.383g/cm3 |
Kokepunkt |
398.4°C at 760 mmHg |
Brytningsindeks |
1.567 |
Flammepunktet |
194.7°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|