ChemNet > CAS > 49673-81-6 L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1)
49673-81-6 L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1)
produktnavn |
L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1) |
Synonymer |
S-(carboxymethyl)-L-cysteine-L-lysine (1:1); (2R)-2-(carboxymethylamino)-3-sulfanyl-propanoic acid; (2S)-2,6-diaminohexanoic acid; L-Lysine S-(Carboxymethyl)-L-Cysteine; L-Lysine-S-carboxymethyl-L-cysteine; L-Lysine S-Carboxymethyl-L-Cysteine |
Molekylær Formel |
C11H23N3O6S |
Molekylvekt |
325.3818 |
InChI |
InChI=1/C6H14N2O2.C5H9NO4S/c7-4-2-1-3-5(8)6(9)10;7-4(8)1-6-3(2-11)5(9)10/h5H,1-4,7-8H2,(H,9,10);3,6,11H,1-2H2,(H,7,8)(H,9,10)/t5-;3-/m00/s1 |
CAS-nummer |
49673-81-6 |
EINECS |
256-425-9 |
Molecular Structure |
|
Kokepunkt |
600.2°C at 760 mmHg |
Flammepunktet |
316.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
|
|