ChemNet > CAS > 499770-88-6 5-(Benzyloxy)-2-bromo-4-methylaniline
499770-88-6 5-(Benzyloxy)-2-bromo-4-methylaniline
produktnavn |
5-(Benzyloxy)-2-bromo-4-methylaniline |
Molekylær Formel |
C14H14BrNO |
Molekylvekt |
292.1711 |
InChI |
InChI=1/C14H14BrNO/c1-10-7-12(15)13(16)8-14(10)17-9-11-5-3-2-4-6-11/h2-8H,9,16H2,1H3 |
CAS-nummer |
499770-88-6 |
Molecular Structure |
|
Tetthet |
1.398g/cm3 |
Smeltepunkt |
138.3℃ |
Kokepunkt |
404.7°C at 760 mmHg |
Brytningsindeks |
1.628 |
Flammepunktet |
198.6°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|