ChemNet > CAS > 5228-49-9 1-Methyl-5-nitroindazole
5228-49-9 1-Methyl-5-nitroindazole
produktnavn |
1-Methyl-5-nitroindazole |
Synonymer |
1-methyl-5-nitro-1H-indazole |
Molekylær Formel |
C8H7N3O2 |
Molekylvekt |
177.1601 |
InChI |
InChI=1/C8H7N3O2/c1-10-8-3-2-7(11(12)13)4-6(8)5-9-10/h2-5H,1H3 |
CAS-nummer |
5228-49-9 |
Molecular Structure |
|
Tetthet |
1.425g/cm3 |
Kokepunkt |
332.863°C at 760 mmHg |
Brytningsindeks |
1.677 |
Flammepunktet |
155.11°C |
Hazard symboler |
|
Risiko Koder |
R20/22:Harmful by inhalation and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|