CAS No: 52663-69-1, Chemical Name: 2,2',3,4,4',5',6-heptachlorobiphenyl
the physical and chemical property of 52663-69-1, 2,2',3,4,4',5',6-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 52663-69-1 2,2',3,4,4',5',6-heptachlorobiphenyl
52663-69-1 2,2',3,4,4',5',6-heptachlorobiphenyl
produktnavn |
2,2',3,4,4',5',6-heptachlorobiphenyl |
Synonymer |
1,1'-biphenyl, 2,2',3,4,4',5',6-heptachloro-; 2,2',3,4,4',5',6-PCB; 52663-69-1 |
Molekylær Formel |
C12H3Cl7 |
Molekylvekt |
395.3232 |
InChI |
InChI=1/C12H3Cl7/c13-5-2-7(15)6(14)1-4(5)10-8(16)3-9(17)11(18)12(10)19/h1-3H |
CAS-nummer |
52663-69-1 |
Molecular Structure |
|
Tetthet |
1.658g/cm3 |
Kokepunkt |
407.2°C at 760 mmHg |
Brytningsindeks |
1.632 |
Flammepunktet |
198.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
|
|