ChemNet > CAS > 52805-36-4 4-Benzyloxybenzonitrile
52805-36-4 4-Benzyloxybenzonitrile
produktnavn |
4-Benzyloxybenzonitrile |
Molekylær Formel |
C14H11NO |
Molekylvekt |
209.2432 |
InChI |
InChI=1/C14H11NO/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9H,11H2 |
CAS-nummer |
52805-36-4 |
Molecular Structure |
|
Tetthet |
1.14g/cm3 |
Kokepunkt |
374°C at 760 mmHg |
Brytningsindeks |
1.597 |
Flammepunktet |
157.6°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|