ChemNet > CAS > 5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
produktnavn |
Methyl 3-methoxy-2-nitrobenzoate |
Synonymer |
3-Methoxy-2-nitrobenzoic acid methyl ester; 3-Methoxy-2-nitromethylbenzoate |
Molekylær Formel |
C9H9NO5 |
Molekylvekt |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-14-7-5-3-4-6(9(11)15-2)8(7)10(12)13/h3-5H,1-2H3 |
CAS-nummer |
5307-17-5 |
Molecular Structure |
|
Tetthet |
1.294g/cm3 |
Kokepunkt |
325.4°C at 760 mmHg |
Brytningsindeks |
1.54 |
Flammepunktet |
151.5°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|