ChemNet > CAS > 5407-98-7 cyclobutyl phenyl ketone
5407-98-7 cyclobutyl phenyl ketone
| produktnavn |
cyclobutyl phenyl ketone |
| Synonymer |
Benzoylcyclobutane; cyclobutyl(phenyl)methanone |
| Molekylær Formel |
C11H12O |
| Molekylvekt |
160.2124 |
| InChI |
InChI=1/C11H12O/c12-11(10-7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
| CAS-nummer |
5407-98-7 |
| EINECS |
226-473-5 |
| Molecular Structure |
|
| Tetthet |
1.082g/cm3 |
| Kokepunkt |
260°C at 760 mmHg |
| Brytningsindeks |
1.563 |
| Flammepunktet |
102.5°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
