produktnavn |
D-glucitol, etoksylatert og propoksylatert (1 - 12,5 mol etoksylatert og 1 - 12,5 mol propoksylatert) |
Synonymer |
Polyoksyetylen (245) polyoksypropylen (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; Polyoksyetylen (500) polyoksypropylen (6) sorbitol; Polyoksypropylen (6) polyoksyetylen (245) sorbitol; Polyoksypropylen (6) polyoksyetylen (500) sorbitol; Poly (oksy(metyl-1,2-etandiyl)oksy-1,2-etandiyl), D-glucitol; Oksiran, 2-metyl-, polymer med oksiran, eter med D-glucitol (6:1); Oksiran, metyl-, polymer med oksiran, eter med D-glucitol (6:1); (2R,3R,4R,5S)-heksan-1,2,3,4,5,6-heksol; 2-metyloksiran; oksiran |
Engelsk navn |
D-Glucitol, ethoxylated and propoxylated (1 - 12.5 moles ethoxylated and 1 - 12.5 moles propoxylated);Polyoxyethylene (245) polyoxypropylene (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; Polyoxyethylene (500) polyoxypropylene (6) sorbitol; Polyoxypropylene (6) polyoxyethylene (245) sorbitol; Polyoxypropylene (6) polyoxyethylene (500) sorbitol; Poly(oxy(methyl-1,2-ethanediyl)oxy-1,2-ethanediyl), D-glucitol; Oxirane, 2-methyl-, polymer with oxirane, ether with D-glucitol (6:1); Oxirane, methyl-, polymer with oxirane, ether with D-glucitol (6:1); (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol; 2-methyloxirane; oxirane |
Molekylær Formel |
C36H74O18 |
Molekylvekt |
794.962 |
InChI |
InChI=1/C6H14O6.6C3H6O.6C2H4O/c7-1-3(9)5(11)6(12)4(10)2-8;6*1-3-2-4-3;6*1-2-3-1/h3-12H,1-2H2;6*3H,2H2,1H3;6*1-2H2/t3-,4+,5-,6-;;;;;;;;;;;;/m1............/s1 |
CAS-nummer |
56449-05-9 |
EINECS |
500-132-3 |
Molecular Structure |
|
Kokepunkt |
494.9°C at 760 mmHg |
Flammepunktet |
292.6°C |
Damptrykk |
7.22E-12mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
|
|