ChemNet > CAS > 57199-00-5 2,4,6-Triisopropylbenzoyl chloride
57199-00-5 2,4,6-Triisopropylbenzoyl chloride
| produktnavn |
2,4,6-Triisopropylbenzoyl chloride |
| Synonymer |
2,4,6-tri(propan-2-yl)benzoyl chloride |
| Molekylær Formel |
C16H23ClO |
| Molekylvekt |
266.8062 |
| InChI |
InChI=1/C16H23ClO/c1-9(2)12-7-13(10(3)4)15(16(17)18)14(8-12)11(5)6/h7-11H,1-6H3 |
| CAS-nummer |
57199-00-5 |
| EINECS |
260-614-1 |
| Molecular Structure |
|
| Tetthet |
1.002g/cm3 |
| Kokepunkt |
329.3°C at 760 mmHg |
| Brytningsindeks |
1.506 |
| Flammepunktet |
153.9°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
