ChemNet > CAS > 576-82-9 5-fluor-1,2,3-tribromobenzen
576-82-9 5-fluor-1,2,3-tribromobenzen
produktnavn |
5-fluor-1,2,3-tribromobenzen |
Synonymer |
; 1,2,3-Tribromo-5-fluorbenzen |
Engelsk navn |
5-Fluoro-1,2,3-tribromobenzene; 1,2,3-Tribromo-5-fluorobenzene |
Molekylær Formel |
C6H2Br3F |
Molekylvekt |
332.7905 |
InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
CAS-nummer |
576-82-9 |
Molecular Structure |
|
Tetthet |
2.34g/cm3 |
Kokepunkt |
274.2°C at 760 mmHg |
Brytningsindeks |
1.61 |
Flammepunktet |
119.6°C |
Damptrykk |
0.0092mmHg at 25°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|