ChemNet > CAS > 6047-91-2 2-Furylglyoxylonitrile
6047-91-2 2-Furylglyoxylonitrile
produktnavn |
2-Furylglyoxylonitrile |
Synonymer |
2-Furoyl cyanide; Furylglyoxylonitrile; alpha-Oxo-2-furanacetonitrile; furan-2-yl(oxo)acetonitrile |
Molekylær Formel |
C6H3NO2 |
Molekylvekt |
121.0935 |
InChI |
InChI=1/C6H3NO2/c7-4-5(8)6-2-1-3-9-6/h1-3H |
CAS-nummer |
6047-91-2 |
EINECS |
227-944-8 |
Molecular Structure |
|
Tetthet |
1.246g/cm3 |
Smeltepunkt |
19-87℃ |
Kokepunkt |
175.8°C at 760 mmHg |
Brytningsindeks |
1.498 |
Flammepunktet |
60.1°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|