ChemNet > CAS > 618-76-8 4-hydroxy-3,5-diiodobenzoic acid
618-76-8 4-hydroxy-3,5-diiodobenzoic acid
| produktnavn |
4-hydroxy-3,5-diiodobenzoic acid |
| Synonymer |
3,5-Diiodo-4-hydroxybenzoic acid |
| Molekylær Formel |
C7H4I2O3 |
| Molekylvekt |
389.9138 |
| InChI |
InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| CAS-nummer |
618-76-8 |
| EINECS |
210-562-0 |
| Molecular Structure |
|
| Tetthet |
2.697g/cm3 |
| Kokepunkt |
346.4°C at 760 mmHg |
| Brytningsindeks |
1.784 |
| Flammepunktet |
163.3°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
