ChemNet > CAS > 62438-03-3 5-Metylisoksazol-3-karboksylsyrehydrazid
62438-03-3 5-Metylisoksazol-3-karboksylsyrehydrazid
produktnavn |
5-Metylisoksazol-3-karboksylsyrehydrazid |
Synonymer |
5-metyl-1,2-oksazol-3-karbohydrazid |
Engelsk navn |
5-Methylisoxazole-3-carboxylic acid hydrazide;5-methyl-1,2-oxazole-3-carbohydrazide |
Molekylær Formel |
C5H7N3O2 |
Molekylvekt |
141.128 |
InChI |
InChI=1/C5H7N3O2/c1-3-2-4(8-10-3)5(9)7-6/h2H,6H2,1H3,(H,7,9) |
CAS-nummer |
62438-03-3 |
Molecular Structure |
|
Tetthet |
1.291g/cm3 |
Brytningsindeks |
1.534 |
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37:Wear suitable protective clothing and gloves.;
|
|