ChemNet > CAS > 626-27-7 Heptanoic anhydride
626-27-7 Heptanoic anhydride
produktnavn |
Heptanoic anhydride |
Synonymer |
Enanthicanhydride; Oenanthic anhydride; Enanthic anhydride |
Molekylær Formel |
C14H26O3 |
Molekylvekt |
242.3544 |
InChI |
InChI=1/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
CAS-nummer |
626-27-7 |
EINECS |
210-940-5 |
Molecular Structure |
|
Tetthet |
0.931g/cm3 |
Smeltepunkt |
-12℃ |
Kokepunkt |
269.5°C at 760 mmHg |
Brytningsindeks |
1.44 |
Flammepunktet |
129.9°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|