ChemNet > CAS > 6359-05-3 Ethyl Eosin (potassium salt)
6359-05-3 Ethyl Eosin (potassium salt)
produktnavn |
Ethyl Eosin (potassium salt) |
Synonymer |
Eosin alcohol soluble; C.I. 45386; Solvent Red 45; ethyl 2-(2,4,5,7-tetrabromo-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoate |
Molekylær Formel |
C22H12Br4O5 |
Molekylvekt |
675.9437 |
InChI |
InChI=1/C22H12Br4O5/c1-2-30-22(29)10-6-4-3-5-9(10)15-11-7-13(23)18(27)16(25)20(11)31-21-12(15)8-14(24)19(28)17(21)26/h3-8,27H,2H2,1H3 |
CAS-nummer |
6359-05-3 |
EINECS |
228-793-0 |
Molecular Structure |
|
Tetthet |
2.18g/cm3 |
Kokepunkt |
661.5°C at 760 mmHg |
Brytningsindeks |
1.77 |
Flammepunktet |
353.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|