ChemNet > CAS > 645-33-0 4-O-Methyldopamine hydrochloride
645-33-0 4-O-Methyldopamine hydrochloride
produktnavn |
4-O-Methyldopamine hydrochloride |
Synonymer |
4-Methoxy TryaMine HCl |
Molekylær Formel |
C9H13NO2.HCl |
Molekylvekt |
203.66 |
InChI |
InChI=1/C9H13NO2/c1-12-9-3-2-7(4-5-10)6-8(9)11/h2-3,6,11H,4-5,10H2,1H3 |
CAS-nummer |
645-33-0 |
EINECS |
211-437-3 |
Molecular Structure |
|
Smeltepunkt |
207-211℃ |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|