ChemNet > CAS > 700-35-6 2-chloro-4-fluoroacetophenone
700-35-6 2-chloro-4-fluoroacetophenone
produktnavn |
2-chloro-4-fluoroacetophenone |
Synonymer |
2'-chloro-4'-fluoroacetophenone; 1-(2-chloro-4-fluoro-phenyl)ethanone |
Molekylær Formel |
C8H6ClFO |
Molekylvekt |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
CAS-nummer |
700-35-6 |
Molecular Structure |
|
Tetthet |
1.259g/cm3 |
Kokepunkt |
203.4°C at 760 mmHg |
Brytningsindeks |
1.512 |
Flammepunktet |
76.814°C |
Hazard symboler |
|
Risiko Koder |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|