ChemNet > CAS > 7206-70-4 4-Amino-5-chloro-2-methoxybenzoic acid
7206-70-4 4-Amino-5-chloro-2-methoxybenzoic acid
| produktnavn |
4-Amino-5-chloro-2-methoxybenzoic acid |
| Synonymer |
4-amino-5-chloro-2-methoxybenzoate |
| Molekylær Formel |
C8H7ClNO3 |
| Molekylvekt |
200.5996 |
| InChI |
InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12)/p-1 |
| CAS-nummer |
7206-70-4 |
| EINECS |
230-582-3 |
| Molecular Structure |
|
| Smeltepunkt |
206-210℃ |
| Kokepunkt |
369.7°C at 760 mmHg |
| Flammepunktet |
177.4°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R22:Harmful if swallowed.;
|
| Sikkerhet Beskrivelse |
S28B:After contact with skin, wash immediately with plenty of water and soap.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
|
|
