ChemNet > CAS > 7697-29-2 4-Chloro-3-methylbenzoic acid
7697-29-2 4-Chloro-3-methylbenzoic acid
produktnavn |
4-Chloro-3-methylbenzoic acid |
Synonymer |
3-Methyl -4-Chlorobenzoic acid; 3-methyl-4-chlorobenzoic acid; 4-CHLORO-M-TOLUIC ACID; 4-Chloro-3-toluic acid; 4-Chloro-3-Methyl |
Molekylær Formel |
C8H7ClO2 |
Molekylvekt |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
CAS-nummer |
7697-29-2 |
Molecular Structure |
|
Tetthet |
1.31g/cm3 |
Kokepunkt |
299°C at 760 mmHg |
Brytningsindeks |
1.573 |
Flammepunktet |
134.6°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|