ChemNet > CAS > 830-03-5 4-Nitrophenyl acetate
830-03-5 4-Nitrophenyl acetate
produktnavn |
4-Nitrophenyl acetate |
Synonymer |
Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
Molekylær Formel |
C8H7NO4 |
Molekylvekt |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
CAS-nummer |
830-03-5 |
EINECS |
212-593-5 |
Molecular Structure |
|
Tetthet |
1.304g/cm3 |
Smeltepunkt |
76-79℃ |
Kokepunkt |
296.8°C at 760 mmHg |
Brytningsindeks |
1.548 |
Flammepunktet |
145.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|