ChemNet > CAS > 871-78-3 N,N'-Diacetylethylenediamine
871-78-3 N,N'-Diacetylethylenediamine
produktnavn |
N,N'-Diacetylethylenediamine |
Synonymer |
N,N-Diacetylethylenediamine; N,N'-ethane-1,2-diyldiacetamide |
Molekylær Formel |
C6H12N2O2 |
Molekylvekt |
144.1717 |
InChI |
InChI=1/C6H12N2O2/c1-5(9)7-3-4-8-6(2)10/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
CAS-nummer |
871-78-3 |
EINECS |
212-811-9 |
Molecular Structure |
|
Tetthet |
1.033g/cm3 |
Kokepunkt |
438.7°C at 760 mmHg |
Brytningsindeks |
1.444 |
Flammepunktet |
214.8°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|