ChemNet > CAS > 999-21-3 Diallyl maleate
999-21-3 Diallyl maleate
produktnavn |
Diallyl maleate |
Synonymer |
Diallyl maleate, (Maleic acid diallyl ester); Maleic acid diallyl ester; diprop-2-en-1-yl (2Z)-but-2-enedioate |
Molekylær Formel |
C10H12O4 |
Molekylvekt |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5- |
CAS-nummer |
999-21-3 |
EINECS |
213-658-0 |
Molecular Structure |
|
Tetthet |
1.064g/cm3 |
Kokepunkt |
263.7°C at 760 mmHg |
Brytningsindeks |
1.469 |
Flammepunktet |
124.6°C |
Hazard symboler |
|
Risiko Koder |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|